| Name | N-benzyloxycarbonyl-3-fluoro-4-morpholinoaniline |
| Synonyms | Linezolid Intermediate 1 Linezolid Benzyl IMpurity Intermediate of Linezolid 3 N-CARBOBENZOXY-3-FLUORO-4-MORPHOLINYL-ANILINE Benzyl (3-fluoro-4-Morpholinophenyl)carbaMate N-BENZYLOXYCARBONYL-3-FLUORO-4-MORPHOLINOANILINE N-benzyloxycarbonyl-3-fluoro-4-morpholinoaniline benzyl (3-fluoro-4-morpholin-4-ylphenyl)carbamate Benzyl 3-Fluoro-4-(4-Morpholinyl)phenyl)carbaMate (3-Fluoro-4-morpholin-4-ylphenyl)carbamic acid benzyl ester N-[3-fluoro-4-(4-morpholinyl)phenyl]carbamic acid (phenylmethyl) ester CarbaMic acid, N-[3-fluoro-4-(4-Morpholinyl)phenyl]-, phenylMethyl ester |
| CAS | 168828-81-7 |
| EINECS | 605-533-8 |
| InChI | InChI=1/C18H19FN2O3/c19-16-12-15(6-7-17(16)21-8-10-23-11-9-21)20-18(22)24-13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,20,22) |
| Molecular Formula | C18H19FN2O3 |
| Molar Mass | 330.35 |
| Density | 1.284±0.06 g/cm3(Predicted) |
| Melting Point | 123.0 to 127.0 °C |
| Boling Point | 451.8±45.0 °C(Predicted) |
| Flash Point | 227°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Vapor Presure | 2.36E-08mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | 12.74±0.70(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.605 |
| Use | [3-fluoro-4-(4-morpholinyl) phenyl] benzyl carbamate Methyl ester is a synthetic intermediate of linezolid dimer, which is an impurity of the antibacterial agent linezolid. |